2-Di-t-butylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl, min. 98% t-butylXPhos
| CAS NO.: |
564483-19-8 |
Catalog: |
AC0155 |
| Formula: |
C29H45P |
Purity: |
98.00% + |
| Molecular Weight: |
424.6 |
Pubchem CID: |
11618717 |
| InChI Key: |
SACNIGZYDTUHKB-UHFFFAOYSA-N |
| Canonical SMILES: |
CC(C)C1=CC(=C(C(=C1)C(C)C)C2=CC=CC=C2P(C(C)(C)C)C(C)(C)C)C(C)C |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0