2-Dicyclohexylphosphino-2',6'-dimethoxybiphenyl
| CAS NO.: |
657408-07-6 |
Catalog: |
AC0151 |
| Formula: |
C26H35O2P |
Purity: |
98.00% + |
| Molecular Weight: |
410.5 |
Pubchem CID: |
11269872 |
| InChI Key: |
VNFWTIYUKDMAOP-UHFFFAOYSA-N |
| Canonical SMILES: |
COC1=C(C(=CC=C1)OC)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0