2-Phenylcarbazole
| CAS NO.: |
88590-00-5 |
Catalog: |
JY002 |
| Formula: |
C18H13N |
Purity: |
99.50% + |
| Molecular Weight: |
243.3 |
Pubchem CID: |
49799641 |
| InChI Key: |
IMLDYQBWZHPGJA-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CC=C(C=C1)C2=CC3=C(C=C2)C4=CC=CC=C4N3 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0