[2,2'-bithiophene]-5-carbonitrile
| CAS NO.: |
16278-99-2 |
Catalog: |
AC0341 |
| Formula: |
C9H5NS2 |
Purity: |
98.00% + |
| Molecular Weight: |
191.3 |
Pubchem CID: |
2739839 |
| InChI Key: |
ANARYBGZNUMARH-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CSC(=C1)C2=CC=C(S2)C#N |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0