3-((4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)methyl)pyridine
| CAS NO.: |
864754-21-2 |
Catalog: |
PRD0809 |
| Formula: |
C15H20BN3O2 |
Purity: |
95.00% + |
| Molecular Weight: |
285.15 |
Pubchem CID: |
17999185 |
| InChI Key: |
LVLQAPQDEZOFQU-UHFFFAOYSA-N |
| Canonical SMILES: |
B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC3=CN=CC=C3 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0