3-(4-bromophenyl)-N-phenylcarbazole
| CAS NO.: |
1028647-93-9 |
Catalog: |
AC0041 |
| Formula: |
C24H16BrN |
Purity: |
98.00% + |
| Molecular Weight: |
398.3 |
Pubchem CID: |
51358293 |
| InChI Key: |
JEYLGFCAZBGCMC-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CC=C(C=C1)N2C3=C(C=C(C=C3)C4=CC=C(C=C4)Br)C5=CC=CC=C52 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0