(3-Methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl)methanol
| CAS NO.: |
103577-66-8 |
Catalog: |
PRD3420 |
| Formula: |
C9H10F3NO2 |
Purity: |
95.00% + |
| Molecular Weight: |
221.18 |
Pubchem CID: |
11229760 |
| InChI Key: |
GNILTGRCVCMPFJ-UHFFFAOYSA-N |
| Canonical SMILES: |
CC1=C(C=CN=C1CO)OCC(F)(F)F |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0