3,3'-Bi-9H-carbazole, 6,6'-dibromo-9,9'-diphenyl-
| CAS NO.: |
354135-75-4 |
Catalog: |
JY092 |
| Formula: |
C36H22Br2N2 |
Purity: |
99.00% + |
| Molecular Weight: |
642.4 |
Pubchem CID: |
131852839 |
| InChI Key: |
VTIPHPNQFUCDAW-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CC=C(C=C1)N2C3=C(C=C(C=C3)C4=CC5=C(C=C4)N(C6=C5C=C(C=C6)Br)C7=CC=CC=C7)C8=C2C=CC(=C8)Br |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0