4-Pyridin-4-yl-benzaldehyde
| CAS NO.: |
99163-12-9 |
Catalog: |
PRD2238 |
| Formula: |
C12H9NO |
Purity: |
98.00% + |
| Molecular Weight: |
183.21 |
Pubchem CID: |
639673 |
| InChI Key: |
MBJXDIYHLGBQOT-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CC(=CC=C1C=O)C2=CC=NC=C2 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0