5-Hydroxyisoindolin-1-one
| CAS NO.: |
252061-66-8 |
Catalog: |
IND674 |
| Formula: |
C8H7NO2 |
Purity: |
97.00% + |
| Molecular Weight: |
149.15 |
Pubchem CID: |
22594207 |
| InChI Key: |
NLNNRNIJRFYGFB-UHFFFAOYSA-N |
| Canonical SMILES: |
C1C2=C(C=CC(=C2)O)C(=O)N1 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0