9-[1,1'-Biphenyl]-4-yl carbazole
| CAS NO.: |
6299-16-7 |
Catalog: |
JY084 |
| Formula: |
C24H17N |
Purity: |
99.00% + |
| Molecular Weight: |
319.4 |
Pubchem CID: |
412897 |
| InChI Key: |
DQMMBEPJQZXXGK-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CC=C(C=C1)C2=CC=C(C=C2)N3C4=CC=CC=C4C5=CC=CC=C53 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0