9-Phenyl-3,3'-bicarbazole
| CAS NO.: |
1060735-14-9 |
Catalog: |
JY089 |
| Formula: |
C30H20N2 |
Purity: |
99.00% + |
| Molecular Weight: |
408.5 |
Pubchem CID: |
59306629 |
| InChI Key: |
GKTLHQFSIDFAJH-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CC=C(C=C1)N2C3=C(C=C(C=C3)C4=CC5=C(C=C4)NC6=CC=CC=C65)C7=CC=CC=C72 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0