9H-Carbazole, 2,7-dimethoxy
| CAS NO.: |
61822-18-2 |
Catalog: |
JY029 |
| Formula: |
C14H13NO2 |
Purity: |
99.50% + |
| Molecular Weight: |
227.26 |
Pubchem CID: |
12339399 |
| InChI Key: |
OFGBQGFYHXYVIA-UHFFFAOYSA-N |
| Canonical SMILES: |
COC1=CC2=C(C=C1)C3=C(N2)C=C(C=C3)OC |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0