N-([1,1'-biphenyl]-4-yl)-3'-(Carbazol-9-yl)-[1,1'-Biphenyl]-4-amine
| CAS NO.: |
1946806-94-5 |
Catalog: |
JY093 |
| Formula: |
C36H26N2 |
Purity: |
99.80% + |
| Molecular Weight: |
486.6 |
Pubchem CID: |
135743556 |
| InChI Key: |
USOQWOFGCYCOSD-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)C4=CC(=CC=C4)N5C6=CC=CC=C6C7=CC=CC=C75 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0