2-Bromo-9-phenyl-9H-carbazole
| CAS NO.: |
94994-62-4 |
Catalog: |
JY015 |
| Formula: |
C18H12BrN |
Purity: |
99.00% + |
| Molecular Weight: |
322.2 |
Pubchem CID: |
66838044 |
| InChI Key: |
SOODLDGRGXOSTA-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CC=C(C=C1)N2C3=CC=CC=C3C4=C2C=C(C=C4)Br |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0