2-Dicyclohexylphosphino-2',6'-di-i-propoxy-1,1'-biphenyl, RuPhos
| CAS NO.: |
787618-22-8 |
Catalog: |
AC0160 |
| Formula: |
C30H43O2P |
Purity: |
98.00% + |
| Molecular Weight: |
466.6 |
Pubchem CID: |
16217985 |
| InChI Key: |
MXFYYFVVIIWKFE-UHFFFAOYSA-N |
| Canonical SMILES: |
CC(C)OC1=C(C(=CC=C1)OC(C)C)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0