Diphenyl-2-pyridylphosphine
| CAS NO.: |
37943-90-1 |
Catalog: |
AC1240 |
| Formula: |
C17H14NP |
Purity: |
98.00% + |
| Molecular Weight: |
263.27 |
Pubchem CID: |
621893 |
| InChI Key: |
SVABQOITNJTVNJ-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=N3 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0